C22H15F4IN6O — CID 118903205
2-[5-fluoro-6-methyl-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[3,4-b]pyridin-3-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118903205) has the molecular formula C22H15F4IN6O and a molecular weight of 582.30 g/mol. Its IUPAC name is 2-[5-fluoro-6-methyl-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[3,4-b]pyridin-3-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-[5-fluoro-6-methyl-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[3,4-b]pyridin-3-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118903205 |
| Molecular Formula | C22H15F4IN6O |
| Molecular Weight | 582.30 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 2-[5-fluoro-6-methyl-1-[(2,3,6-trifluorophenyl)methyl]pyrazolo[3,4-b]pyridin-3-yl]-4-iodo-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1nc2c(cc1F)c(-c1nc(I)c3c(n1)NC(=O)C3(C)C)nn2Cc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C22H15F4IN6O/c1-8-13(25)6-9-16(19-29-17(27)14-18(30-19)31-21(34)22(14,2)3)32-33(20(9)28-8)7-10-11(23)4-5-12(24)15(10)26/h4-6H,7H2,1-3H3,(H,29,30,31,34) |
| InChIKey | KTPAWNYTRCCIDP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|