C20H15F3N6OS — CID 46223465
4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]thieno[2,3-c]pyrazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 46223465) has the molecular formula C20H15F3N6OS and a molecular weight of 444.44 g/mol. Its IUPAC name is 4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]thieno[2,3-c]pyrazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]thieno[2,3-c]pyrazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 46223465 |
| Molecular Formula | C20H15F3N6OS |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-amino-5,5-dimethyl-2-[3-[(2,3,6-trifluorophenyl)methyl]thieno[2,3-c]pyrazol-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-n3nc(Cc4c(F)ccc(F)c4F)c4ccsc43)nc(N)c21 |
| InChI | InChI=1S/C20H15F3N6OS/c1-20(2)13-15(24)25-19(27-16(13)26-18(20)30)29-17-8(5-6-31-17)12(28-29)7-9-10(21)3-4-11(22)14(9)23/h3-6H,7H2,1-2H3,(H3,24,25,26,27,30) |
| InChIKey | KUMDWDIUXBPHMS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|