C28H20F4N6O — CID 46220614
4-amino-2-[6-(3-fluorophenyl)-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 46220614) has the molecular formula C28H20F4N6O and a molecular weight of 532.50 g/mol. Its IUPAC name is 4-amino-2-[6-(3-fluorophenyl)-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[6-(3-fluorophenyl)-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 46220614 |
| Molecular Formula | C28H20F4N6O |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 4-amino-2-[6-(3-fluorophenyl)-3-[(2,3,6-trifluorophenyl)methyl]imidazo[1,5-a]pyridin-1-yl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(-c3nc(Cc4c(F)ccc(F)c4F)n4cc(-c5cccc(F)c5)ccc34)nc(N)c21 |
| InChI | InChI=1S/C28H20F4N6O/c1-28(2)21-24(33)35-26(36-25(21)37-27(28)39)23-19-9-6-14(13-4-3-5-15(29)10-13)12-38(19)20(34-23)11-16-17(30)7-8-18(31)22(16)32/h3-10,12H,11H2,1-2H3,(H3,33,35,36,37,39) |
| InChIKey | IQLGXTXIVZBXOC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|