C19H14F6N6O3 — CID 118659119
4-amino-2-[6-fluoro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid (PubChem CID 118659119) has the molecular formula C19H14F6N6O3 and a molecular weight of 488.35 g/mol. Its IUPAC name is 4-amino-2-[6-fluoro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-[6-fluoro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 118659119 |
| Molecular Formula | C19H14F6N6O3 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 4-amino-2-[6-fluoro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
| SMILES | CC1(C(=O)O)C(=O)Nc2nc(-c3nc(CCC(F)(F)C(F)(F)F)n4cc(F)ccc34)nc(N)c21 |
| InChI | InChI=1S/C19H14F6N6O3/c1-17(16(33)34)10-12(26)28-14(29-13(10)30-15(17)32)11-8-3-2-7(20)6-31(8)9(27-11)4-5-18(21,22)19(23,24)25/h2-3,6H,4-5H2,1H3,(H,33,34)(H3,26,28,29,30,32) |
| InChIKey | WBRBKZMKFYNHPH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|