C18H16F5N9O2 — CID 118151336
4-amino-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 118151336) has the molecular formula C18H16F5N9O2 and a molecular weight of 485.38 g/mol. Its IUPAC name is 4-amino-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118151336 |
| Molecular Formula | C18H16F5N9O2 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-amino-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cn1ncc2c(-c3nc(N)c4c(n3)NC(=O)C4(C)C(N)=O)nc(CCC(F)(F)C(F)(F)F)nc21 |
| InChI | InChI=1S/C18H16F5N9O2/c1-16(14(25)33)8-10(24)29-12(30-11(8)31-15(16)34)9-6-5-26-32(2)13(6)28-7(27-9)3-4-17(19,20)18(21,22)23/h5H,3-4H2,1-2H3,(H2,25,33)(H3,24,29,30,31,34) |
| InChIKey | FDIXLORYDLGMEI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 167.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|