C23H18F5IN8O — CID 122616710
4-amino-5-(4-iodophenyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 122616710) has the molecular formula C23H18F5IN8O and a molecular weight of 647.36 g/mol. Its IUPAC name is 4-amino-5-(4-iodophenyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(4-iodophenyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 122616710 |
| Molecular Formula | C23H18F5IN8O |
| Molecular Weight | 647.36 g/mol |
| Exact Mass | 647.08 |
| IUPAC Name | 4-amino-5-(4-iodophenyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | [2H]C([2H])([2H])n1ncc2c(-c3nc(N)c4c(n3)NC(=O)C4(C)c3ccc(I)cc3)nc(CCC(F)(F)C(F)(F)F)nc21 |
| InChI | InChI=1S/C23H18F5IN8O/c1-21(10-3-5-11(29)6-4-10)14-16(30)34-18(35-17(14)36-20(21)38)15-12-9-31-37(2)19(12)33-13(32-15)7-8-22(24,25)23(26,27)28/h3-6,9H,7-8H2,1-2H3,(H3,30,34,35,36,38)/i2D3 |
| InChIKey | DNQIBTSYXMKRJV-BMSJAHLVSA-N |
| XLogP | 4.40 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|