C18H17F5N8O2 — CID 118151341
4-amino-5-methoxy-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118151341) has the molecular formula C18H17F5N8O2 and a molecular weight of 472.38 g/mol. Its IUPAC name is 4-amino-5-methoxy-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-methoxy-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118151341 |
| Molecular Formula | C18H17F5N8O2 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 4-amino-5-methoxy-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | COC1(C)C(=O)Nc2nc(-c3nc(CCC(F)(F)C(F)(F)F)nc4c3cnn4C)nc(N)c21 |
| InChI | InChI=1S/C18H17F5N8O2/c1-16(33-3)9-11(24)28-13(29-12(9)30-15(16)32)10-7-6-25-31(2)14(7)27-8(26-10)4-5-17(19,20)18(21,22)23/h6H,4-5H2,1-3H3,(H3,24,28,29,30,32) |
| InChIKey | JOUJRRSHZUAAOV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|