C22H26F5N11O — CID 144862212
4-amino-5-[(Z)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 144862212) has the molecular formula C22H26F5N11O and a molecular weight of 555.52 g/mol. Its IUPAC name is 4-amino-5-[(Z)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-[(Z)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 144862212 |
| Molecular Formula | C22H26F5N11O |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 4-amino-5-[(Z)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC(C)N(N)/C=C(\N)C1(C)C(=O)Nc2nc(-c3nc(CCC(F)(F)C(F)(F)F)nc4c3cnn4C)nc(N)c21 |
| InChI | InChI=1S/C22H26F5N11O/c1-9(2)38(30)8-11(28)20(3)13-15(29)34-17(35-16(13)36-19(20)39)14-10-7-31-37(4)18(10)33-12(32-14)5-6-21(23,24)22(25,26)27/h7-9H,5-6,28,30H2,1-4H3,(H3,29,34,35,36,39)/b11-8- |
| InChIKey | FTQIHUSJNBASNS-FLIBITNWSA-N |
| XLogP | 2.13 |
| TPSA | 179.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|