C18H18F5N9O2 — CID 123631423
4-amino-5-[amino(hydroxy)methyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 123631423) has the molecular formula C18H18F5N9O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is 4-amino-5-[amino(hydroxy)methyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-[amino(hydroxy)methyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 123631423 |
| Molecular Formula | C18H18F5N9O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-amino-5-[amino(hydroxy)methyl]-5-methyl-2-[1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cn1ncc2c(-c3nc(N)c4c(n3)NC(=O)C4(C)C(N)O)nc(CCC(F)(F)C(F)(F)F)nc21 |
| InChI | InChI=1S/C18H18F5N9O2/c1-16(14(25)33)8-10(24)29-12(30-11(8)31-15(16)34)9-6-5-26-32(2)13(6)28-7(27-9)3-4-17(19,20)18(21,22)23/h5,14,33H,3-4,25H2,1-2H3,(H3,24,29,30,31,34) |
| InChIKey | AHXXKTICBXQCPM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|