C22H17BrClF3N6O — CID 123670299
4-amino-2-[[1-(2-bromo-5-chlorophenyl)-2-(2,3,6-trifluorophenyl)ethyl]diazenyl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 123670299) has the molecular formula C22H17BrClF3N6O and a molecular weight of 553.77 g/mol. Its IUPAC name is 4-amino-2-[[1-(2-bromo-5-chlorophenyl)-2-(2,3,6-trifluorophenyl)ethyl]diazenyl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[[1-(2-bromo-5-chlorophenyl)-2-(2,3,6-trifluorophenyl)ethyl]diazenyl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 123670299 |
| Molecular Formula | C22H17BrClF3N6O |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | 4-amino-2-[[1-(2-bromo-5-chlorophenyl)-2-(2,3,6-trifluorophenyl)ethyl]diazenyl]-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(/N=N/C(Cc3c(F)ccc(F)c3F)c3cc(Cl)ccc3Br)nc(N)c21 |
| InChI | InChI=1S/C22H17BrClF3N6O/c1-22(2)16-18(28)29-21(31-19(16)30-20(22)34)33-32-15(10-7-9(24)3-4-12(10)23)8-11-13(25)5-6-14(26)17(11)27/h3-7,15H,8H2,1-2H3,(H3,28,29,30,31,34)/b33-32+ |
| InChIKey | VTFHBJPDRCHPEG-ULIFNZDWSA-N |
| XLogP | 6.19 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|