C17H17F3N4O — CID 58425675
4-amino-5,5-dimethyl-2-[2-(2,3,6-trifluorophenyl)ethyl]-6,8-dihydropyrido[2,3-d]pyrimidin-7-one (PubChem CID 58425675) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is 4-amino-5,5-dimethyl-2-[2-(2,3,6-trifluorophenyl)ethyl]-6,8-dihydropyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-amino-5,5-dimethyl-2-[2-(2,3,6-trifluorophenyl)ethyl]-6,8-dihydropyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 58425675 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-amino-5,5-dimethyl-2-[2-(2,3,6-trifluorophenyl)ethyl]-6,8-dihydropyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC1(C)CC(=O)Nc2nc(CCc3c(F)ccc(F)c3F)nc(N)c21 |
| InChI | InChI=1S/C17H17F3N4O/c1-17(2)7-12(25)24-16-13(17)15(21)22-11(23-16)6-3-8-9(18)4-5-10(19)14(8)20/h4-5H,3,6-7H2,1-2H3,(H3,21,22,23,24,25) |
| InChIKey | LVVSXWMDGXAWAB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|