C27H20FNO2S — CID 118903754
1-[4-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]phenyl]ethanone (PubChem CID 118903754) has the molecular formula C27H20FNO2S and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-[4-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]phenyl]ethanone.
| Compound Name | 1-[4-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 118903754 |
| Molecular Formula | C27H20FNO2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-[4-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2c(C#CCCO)sc(-c3ccc(F)cc3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C27H20FNO2S/c1-18(31)19-5-7-20(8-6-19)25-24(4-2-3-17-30)32-27(22-9-11-23(28)12-10-22)26(25)21-13-15-29-16-14-21/h5-16,30H,3,17H2,1H3 |
| InChIKey | PNLHOHUFECGJIG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|