C20H16N2O3 — CID 118905169
5-[(4-methoxyphenyl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole (PubChem CID 118905169) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole.
| Compound Name | 5-[(4-methoxyphenyl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 118905169 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-[(4-methoxyphenyl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole |
| SMILES | COc1ccc(COc2ccc3oc(-c4cccnc4)nc3c2)cc1 |
| InChI | InChI=1S/C20H16N2O3/c1-23-16-6-4-14(5-7-16)13-24-17-8-9-19-18(11-17)22-20(25-19)15-3-2-10-21-12-15/h2-12H,13H2,1H3 |
| InChIKey | MNHRARWXZWKQCG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |