C21H20N4O2 — CID 153469818
5-[(5-butylpyrazin-2-yl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole (PubChem CID 153469818) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 5-[(5-butylpyrazin-2-yl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole.
| Compound Name | 5-[(5-butylpyrazin-2-yl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 153469818 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 5-[(5-butylpyrazin-2-yl)methoxy]-2-pyridin-3-yl-1,3-benzoxazole |
| SMILES | CCCCc1cnc(COc2ccc3oc(-c4cccnc4)nc3c2)cn1 |
| InChI | InChI=1S/C21H20N4O2/c1-2-3-6-16-12-24-17(13-23-16)14-26-18-7-8-20-19(10-18)25-21(27-20)15-5-4-9-22-11-15/h4-5,7-13H,2-3,6,14H2,1H3 |
| InChIKey | YRXUGYOLKKLFTO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |