C21H19N3O4 — CID 159177911
5-[[5-(ethoxymethoxy)-2-pyridinyl]methoxy]-2-pyridin-3-yl-1,3-benzoxazole (PubChem CID 159177911) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 5-[[5-(ethoxymethoxy)-2-pyridinyl]methoxy]-2-pyridin-3-yl-1,3-benzoxazole.
| Compound Name | 5-[[5-(ethoxymethoxy)-2-pyridinyl]methoxy]-2-pyridin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 159177911 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[[5-(ethoxymethoxy)-2-pyridinyl]methoxy]-2-pyridin-3-yl-1,3-benzoxazole |
| SMILES | CCOCOc1ccc(COc2ccc3oc(-c4cccnc4)nc3c2)nc1 |
| InChI | InChI=1S/C21H19N3O4/c1-2-25-14-27-18-6-5-16(23-12-18)13-26-17-7-8-20-19(10-17)24-21(28-20)15-4-3-9-22-11-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | KMNBHEVQLSVFFO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|