C24H22FN5O3 — CID 118906468
2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]-N-methylacetamide (PubChem CID 118906468) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]-N-methylacetamide.
| Compound Name | 2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 118906468 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1C(=O)N(c2cccc(CF)c2)C2=C(C(=O)NCC2)C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H22FN5O3/c1-27-20(31)14-29-22(17-7-5-15(13-26)6-8-17)21-19(9-10-28-23(21)32)30(24(29)33)18-4-2-3-16(11-18)12-25/h2-8,11,22H,9-10,12,14H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | CSDXYAKOKJGZNV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |