C23H20FN5O3 — CID 118906492
2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]acetamide (PubChem CID 118906492) has the molecular formula C23H20FN5O3 and a molecular weight of 433.44 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | 2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 118906492 |
| Molecular Formula | C23H20FN5O3 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-[4-(4-cyanophenyl)-1-[3-(fluoromethyl)phenyl]-2,5-dioxo-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-3-yl]acetamide |
| SMILES | N#Cc1ccc(C2C3=C(CCNC3=O)N(c3cccc(CF)c3)C(=O)N2CC(N)=O)cc1 |
| InChI | InChI=1S/C23H20FN5O3/c24-11-15-2-1-3-17(10-15)29-18-8-9-27-22(31)20(18)21(28(23(29)32)13-19(26)30)16-6-4-14(12-25)5-7-16/h1-7,10,21H,8-9,11,13H2,(H2,26,30)(H,27,31) |
| InChIKey | CMSMAMFZSPJBIS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |