C19H22N2O2 — CID 118907039
tert-butyl 3-(1,5-dimethylindol-3-yl)pyrrole-1-carboxylate (PubChem CID 118907039) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl 3-(1,5-dimethylindol-3-yl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-(1,5-dimethylindol-3-yl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 118907039 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl 3-(1,5-dimethylindol-3-yl)pyrrole-1-carboxylate |
| SMILES | Cc1ccc2c(c1)c(-c1ccn(C(=O)OC(C)(C)C)c1)cn2C |
| InChI | InChI=1S/C19H22N2O2/c1-13-6-7-17-15(10-13)16(12-20(17)5)14-8-9-21(11-14)18(22)23-19(2,3)4/h6-12H,1-5H3 |
| InChIKey | DTICJYONEBGKBC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |