C10H16N2O4S — CID 175545079
tert-butyl 3-(methanesulfonamido)pyrrole-1-carboxylate (PubChem CID 175545079) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is tert-butyl 3-(methanesulfonamido)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-(methanesulfonamido)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 175545079 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | tert-butyl 3-(methanesulfonamido)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C10H16N2O4S/c1-10(2,3)16-9(13)12-6-5-8(7-12)11-17(4,14)15/h5-7,11H,1-4H3 |
| InChIKey | ZIQYKKXONPOBQK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |