About tert-butyl pyrido[3,4-b]indole-2-carboxylate
tert-butyl pyrido[3,4-b]indole-2-carboxylate (PubChem CID 143173317) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is tert-butyl pyrido[3,4-b]indole-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl pyrido[3,4-b]indole-2-carboxylate |
| PubChem CID | 143173317 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | tert-butyl pyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2c3ccccc3nc-2c1 |
| InChI | InChI=1S/C16H16N2O2/c1-16(2,3)20-15(19)18-9-8-12-11-6-4-5-7-13(11)17-14(12)10-18/h4-10H,1-3H3 |
| InChIKey | KKKLCFZDZPITIH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl pyrido[3,4-b]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl pyrido[3,4-b]indole-2-carboxylate?
The IUPAC name of tert-butyl pyrido[3,4-b]indole-2-carboxylate (CID 143173317) is tert-butyl pyrido[3,4-b]indole-2-carboxylate.
What is the SMILES notation for tert-butyl pyrido[3,4-b]indole-2-carboxylate?
The canonical SMILES for tert-butyl pyrido[3,4-b]indole-2-carboxylate is CC(C)(C)OC(=O)n1ccc2c3ccccc3nc-2c1.
What is the InChIKey of tert-butyl pyrido[3,4-b]indole-2-carboxylate?
The InChIKey is KKKLCFZDZPITIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-16(2,3)20-15(19)18-9-8-12-11-6-4-5-7-13(11)17-14(12)10-18/h4-10H,1-3H3.
What are the key properties of tert-butyl pyrido[3,4-b]indole-2-carboxylate?
tert-butyl pyrido[3,4-b]indole-2-carboxylate has a molecular weight of 268.32 g/mol, XLogP of 3.92, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl pyrido[3,4-b]indole-2-carboxylate is sourced from PubChem (CID 143173317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).