C18H18N2O4 — CID 141155305
2-O-tert-butyl 8-O-methyl pyrido[4,3-b]indole-2,8-dicarboxylate (PubChem CID 141155305) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-O-tert-butyl 8-O-methyl pyrido[4,3-b]indole-2,8-dicarboxylate.
| Compound Name | 2-O-tert-butyl 8-O-methyl pyrido[4,3-b]indole-2,8-dicarboxylate |
|---|---|
| PubChem CID | 141155305 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-O-tert-butyl 8-O-methyl pyrido[4,3-b]indole-2,8-dicarboxylate |
| SMILES | COC(=O)c1ccc2nc3ccn(C(=O)OC(C)(C)C)cc-3c2c1 |
| InChI | InChI=1S/C18H18N2O4/c1-18(2,3)24-17(22)20-8-7-15-13(10-20)12-9-11(16(21)23-4)5-6-14(12)19-15/h5-10H,1-4H3 |
| InChIKey | FLYPUULSVAYETP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |