About acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium
acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium (PubChem CID 58101913) has the molecular formula C12H17NO3Y-2
and a molecular weight of 312.18 g/mol. Its IUPAC name is acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium.
Molecular Properties
| Compound Name | acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium |
| PubChem CID | 58101913 |
| Molecular Formula | C12H17NO3Y-2 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium |
| SMILES | [CH2-]C=O.[CH2-]c1ccn(C(=O)OC(C)(C)C)c1.[Y] |
| InChI | InChI=1S/C10H14NO2.C2H3O.Y/c1-8-5-6-11(7-8)9(12)13-10(2,3)4;1-2-3;/h5-7H,1H2,2-4H3;2H,1H2;/q2*-1; |
| InChIKey | HINSQXCCXVYHGB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium?
The IUPAC name of acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium (CID 58101913) is acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium.
What is the SMILES notation for acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium?
The canonical SMILES for acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium is [CH2-]C=O.[CH2-]c1ccn(C(=O)OC(C)(C)C)c1.[Y].
What is the InChIKey of acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium?
The InChIKey is HINSQXCCXVYHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NO2.C2H3O.Y/c1-8-5-6-11(7-8)9(12)13-10(2,3)4;1-2-3;/h5-7H,1H2,2-4H3;2H,1H2;/q2*-1;.
What are the key properties of acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium?
acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium has a molecular weight of 312.18 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;tert-butyl 3-methanidylpyrrole-1-carboxylate;yttrium is sourced from PubChem (CID 58101913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).