C20H18ClN5O — CID 118908068
2-[3-[[5-chloro-2-(5-methoxy-2-methylanilino)pyrimidin-4-yl]amino]phenyl]acetonitrile (PubChem CID 118908068) has the molecular formula C20H18ClN5O and a molecular weight of 379.85 g/mol. Its IUPAC name is 2-[3-[[5-chloro-2-(5-methoxy-2-methylanilino)pyrimidin-4-yl]amino]phenyl]acetonitrile.
| Compound Name | 2-[3-[[5-chloro-2-(5-methoxy-2-methylanilino)pyrimidin-4-yl]amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 118908068 |
| Molecular Formula | C20H18ClN5O |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[3-[[5-chloro-2-(5-methoxy-2-methylanilino)pyrimidin-4-yl]amino]phenyl]acetonitrile |
| SMILES | COc1ccc(C)c(Nc2ncc(Cl)c(Nc3cccc(CC#N)c3)n2)c1 |
| InChI | InChI=1S/C20H18ClN5O/c1-13-6-7-16(27-2)11-18(13)25-20-23-12-17(21)19(26-20)24-15-5-3-4-14(10-15)8-9-22/h3-7,10-12H,8H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | SNKNAHOAMFFCOW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |