C32H36BrN7O4S — CID 118912892
2-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indol-1-yl]ethyl 4-bromobenzenesulfonate (PubChem CID 118912892) has the molecular formula C32H36BrN7O4S and a molecular weight of 694.66 g/mol. Its IUPAC name is 2-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indol-1-yl]ethyl 4-bromobenzenesulfonate.
| Compound Name | 2-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indol-1-yl]ethyl 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 118912892 |
| Molecular Formula | C32H36BrN7O4S |
| Molecular Weight | 694.66 g/mol |
| Exact Mass | 693.17 |
| IUPAC Name | 2-[3-[2-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyanilino]pyrimidin-4-yl]indol-1-yl]ethyl 4-bromobenzenesulfonate |
| SMILES | COc1cc(N(C)CCN(C)C)c(N)cc1Nc1nccc(-c2cn(CCOS(=O)(=O)c3ccc(Br)cc3)c3ccccc23)n1 |
| InChI | InChI=1S/C32H36BrN7O4S/c1-38(2)15-16-39(3)30-20-31(43-4)28(19-26(30)34)37-32-35-14-13-27(36-32)25-21-40(29-8-6-5-7-24(25)29)17-18-44-45(41,42)23-11-9-22(33)10-12-23/h5-14,19-21H,15-18,34H2,1-4H3,(H,35,36,37) |
| InChIKey | SJBLOPUQGYHLSG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|