C26H29N7O — CID 121280393
5-methoxy-1-N-methyl-1-N-[2-(methylamino)ethyl]-4-N-[4-(1-prop-2-ynylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine (PubChem CID 121280393) has the molecular formula C26H29N7O and a molecular weight of 455.57 g/mol. Its IUPAC name is 5-methoxy-1-N-methyl-1-N-[2-(methylamino)ethyl]-4-N-[4-(1-prop-2-ynylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine.
| Compound Name | 5-methoxy-1-N-methyl-1-N-[2-(methylamino)ethyl]-4-N-[4-(1-prop-2-ynylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 121280393 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 5-methoxy-1-N-methyl-1-N-[2-(methylamino)ethyl]-4-N-[4-(1-prop-2-ynylindol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine |
| SMILES | C#CCn1cc(-c2ccnc(Nc3cc(N)c(N(C)CCNC)cc3OC)n2)c2ccccc21 |
| InChI | InChI=1S/C26H29N7O/c1-5-13-33-17-19(18-8-6-7-9-23(18)33)21-10-11-29-26(30-21)31-22-15-20(27)24(16-25(22)34-4)32(3)14-12-28-2/h1,6-11,15-17,28H,12-14,27H2,2-4H3,(H,29,30,31) |
| InChIKey | CBYAVSHMNIQCBI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|