C29H35N7O6S — CID 154631294
[3-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[1-(hydroxymethyl)indol-3-yl]pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-en-2-yl] methanesulfonate (PubChem CID 154631294) has the molecular formula C29H35N7O6S and a molecular weight of 609.71 g/mol. Its IUPAC name is [3-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[1-(hydroxymethyl)indol-3-yl]pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-en-2-yl] methanesulfonate.
| Compound Name | [3-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[1-(hydroxymethyl)indol-3-yl]pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 154631294 |
| Molecular Formula | C29H35N7O6S |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | [3-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-[1-(hydroxymethyl)indol-3-yl]pyrimidin-2-yl]amino]-4-methoxyanilino]-3-oxoprop-1-en-2-yl] methanesulfonate |
| SMILES | C=C(OS(C)(=O)=O)C(=O)Nc1cc(Nc2nccc(-c3cn(CO)c4ccccc34)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C29H35N7O6S/c1-19(42-43(6,39)40)28(38)31-23-15-24(27(41-5)16-26(23)35(4)14-13-34(2)3)33-29-30-12-11-22(32-29)21-17-36(18-37)25-10-8-7-9-20(21)25/h7-12,15-17,37H,1,13-14,18H2,2-6H3,(H,31,38)(H,30,32,33) |
| InChIKey | MDGWMUBUKRMASE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|