C10H10N4 — CID 118914760
2-pyridin-3-ylpyridine-3,4-diamine (PubChem CID 118914760) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 2-pyridin-3-ylpyridine-3,4-diamine.
| Compound Name | 2-pyridin-3-ylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 118914760 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-pyridin-3-ylpyridine-3,4-diamine |
| SMILES | Nc1ccnc(-c2cccnc2)c1N |
| InChI | InChI=1S/C10H10N4/c11-8-3-5-14-10(9(8)12)7-2-1-4-13-6-7/h1-6H,12H2,(H2,11,14) |
| InChIKey | QWRALSGVOYAMNK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |