C25H37N3O3 — CID 118914874
[(E)-8-[[(5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamic acid (PubChem CID 118914874) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is [(E)-8-[[(5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamic acid.
| Compound Name | [(E)-8-[[(5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamic acid |
|---|---|
| PubChem CID | 118914874 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | [(E)-8-[[(5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamic acid |
| SMILES | CC(C)CC(/C=C/CC(=O)NC1CC2CCC[C@@H](C1)N2Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C25H37N3O3/c1-18(2)14-20(27-25(30)31)10-6-13-24(29)26-21-15-22-11-7-12-23(16-21)28(22)17-19-8-4-3-5-9-19/h3-6,8-10,18,20-23,27H,7,11-17H2,1-2H3,(H,26,29)(H,30,31)/b10-6+/t20?,21?,22-,23?/m0/s1 |
| InChIKey | JSJAJYLKJQLZJO-KQSPJDJESA-N |
| XLogP | 4.32 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|