C29H45N3O3 — CID 71732264
tert-butyl N-[(E,4S)-8-[[(1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate (PubChem CID 71732264) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is tert-butyl N-[(E,4S)-8-[[(1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,4S)-8-[[(1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate |
|---|---|
| PubChem CID | 71732264 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | tert-butyl N-[(E,4S)-8-[[(1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate |
| SMILES | CC(C)C[C@@H](/C=C/CC(=O)NC1C[C@H]2CCC[C@@H](C1)N2Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H45N3O3/c1-21(2)17-23(31-28(34)35-29(3,4)5)13-9-16-27(33)30-24-18-25-14-10-15-26(19-24)32(25)20-22-11-7-6-8-12-22/h6-9,11-13,21,23-26H,10,14-20H2,1-5H3,(H,30,33)(H,31,34)/b13-9+/t23-,24?,25-,26+/m1/s1 |
| InChIKey | HIBZQVSUZVDHSV-NUZIZTSVSA-N |
| XLogP | 5.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|