C24H45N3O3 — CID 58345830
tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate (PubChem CID 58345830) has the molecular formula C24H45N3O3 and a molecular weight of 423.64 g/mol. Its IUPAC name is tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate |
|---|---|
| PubChem CID | 58345830 |
| Molecular Formula | C24H45N3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate |
| SMILES | CC(C)C[C@@H](/C=C/CC(=O)NC1CC(C)(C)N(C)C(C)(C)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H45N3O3/c1-17(2)14-18(26-21(29)30-22(3,4)5)12-11-13-20(28)25-19-15-23(6,7)27(10)24(8,9)16-19/h11-12,17-19H,13-16H2,1-10H3,(H,25,28)(H,26,29)/b12-11+/t18-/m1/s1 |
| InChIKey | DWIOJJCLZPBMOW-IENJSVCTSA-N |
| XLogP | 4.64 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|