C14H20N2O7S — CID 118915477
(2R,3R)-4-(methoxyamino)-2-methyl-4-oxo-3-(phenylmethoxycarbonylamino)butane-1-sulfonic acid (PubChem CID 118915477) has the molecular formula C14H20N2O7S and a molecular weight of 360.39 g/mol. Its IUPAC name is (2R,3R)-4-(methoxyamino)-2-methyl-4-oxo-3-(phenylmethoxycarbonylamino)butane-1-sulfonic acid.
| Compound Name | (2R,3R)-4-(methoxyamino)-2-methyl-4-oxo-3-(phenylmethoxycarbonylamino)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 118915477 |
| Molecular Formula | C14H20N2O7S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2R,3R)-4-(methoxyamino)-2-methyl-4-oxo-3-(phenylmethoxycarbonylamino)butane-1-sulfonic acid |
| SMILES | CONC(=O)[C@H](NC(=O)OCc1ccccc1)[C@@H](C)CS(=O)(=O)O |
| InChI | InChI=1S/C14H20N2O7S/c1-10(9-24(19,20)21)12(13(17)16-22-2)15-14(18)23-8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,15,18)(H,16,17)(H,19,20,21)/t10-,12+/m0/s1 |
| InChIKey | CZUCTZOVSFJRNG-CMPLNLGQSA-N |
| XLogP | 0.48 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|