C14H20NO8P — CID 162415252
methyl (2S,3R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 162415252) has the molecular formula C14H20NO8P and a molecular weight of 361.29 g/mol. Its IUPAC name is methyl (2S,3R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2S,3R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 162415252 |
| Molecular Formula | C14H20NO8P |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | methyl (2S,3R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](C)OP(=O)(O)OC |
| InChI | InChI=1S/C14H20NO8P/c1-10(23-24(18,19)21-3)12(13(16)20-2)15-14(17)22-9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H,15,17)(H,18,19)/t10-,12+/m1/s1 |
| InChIKey | GVGWSNCTKMQNAN-PWSUYJOCSA-N |
| XLogP | 1.61 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|