C17H15FN2O3 — CID 118915605
[4-(2-fluorophenyl)phenyl]methyl-(2-oxoazetidin-3-yl)carbamic acid (PubChem CID 118915605) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is [4-(2-fluorophenyl)phenyl]methyl-(2-oxoazetidin-3-yl)carbamic acid.
| Compound Name | [4-(2-fluorophenyl)phenyl]methyl-(2-oxoazetidin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 118915605 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [4-(2-fluorophenyl)phenyl]methyl-(2-oxoazetidin-3-yl)carbamic acid |
| SMILES | O=C1NCC1N(Cc1ccc(-c2ccccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C17H15FN2O3/c18-14-4-2-1-3-13(14)12-7-5-11(6-8-12)10-20(17(22)23)15-9-19-16(15)21/h1-8,15H,9-10H2,(H,19,21)(H,22,23) |
| InChIKey | ROHYQTLPRGJMNN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |