About [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid
[(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid (PubChem CID 90424935) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid.
Molecular Properties
| Compound Name | [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid |
| PubChem CID | 90424935 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid |
| SMILES | CC1(C)NC(=O)[C@@H]1N(Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H20N2O3/c1-19(2)16(17(22)20-19)21(18(23)24)12-13-8-10-15(11-9-13)14-6-4-3-5-7-14/h3-11,16H,12H2,1-2H3,(H,20,22)(H,23,24)/t16-/m0/s1 |
| InChIKey | RXDJAJVAZIMBKC-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid?
The IUPAC name of [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid (CID 90424935) is [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid.
What is the SMILES notation for [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid?
The canonical SMILES for [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid is CC1(C)NC(=O)[C@@H]1N(Cc1ccc(-c2ccccc2)cc1)C(=O)O.
What is the InChIKey of [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid?
The InChIKey is RXDJAJVAZIMBKC-INIZCTEOSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-19(2)16(17(22)20-19)21(18(23)24)12-13-8-10-15(11-9-13)14-6-4-3-5-7-14/h3-11,16H,12H2,1-2H3,(H,20,22)(H,23,24)/t16-/m0/s1.
What are the key properties of [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid?
[(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid has a molecular weight of 324.38 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2,2-dimethyl-4-oxoazetidin-3-yl]-[(4-phenylphenyl)methyl]carbamic acid is sourced from PubChem (CID 90424935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).