C18H21NO2 — CID 15670577
N-hydroxy-2,2-dimethyl-N-[(4-phenylphenyl)methyl]propanamide (PubChem CID 15670577) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethyl-N-[(4-phenylphenyl)methyl]propanamide.
| Compound Name | N-hydroxy-2,2-dimethyl-N-[(4-phenylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 15670577 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-hydroxy-2,2-dimethyl-N-[(4-phenylphenyl)methyl]propanamide |
| SMILES | CC(C)(C)C(=O)N(O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-18(2,3)17(20)19(21)13-14-9-11-16(12-10-14)15-7-5-4-6-8-15/h4-12,21H,13H2,1-3H3 |
| InChIKey | KGFUMGXKTMHANW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|