C24H25NO — CID 4276437
N-benzyl-2,2-dimethyl-N-(2-phenylphenyl)propanamide (PubChem CID 4276437) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-N-(2-phenylphenyl)propanamide.
| Compound Name | N-benzyl-2,2-dimethyl-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 4276437 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-benzyl-2,2-dimethyl-N-(2-phenylphenyl)propanamide |
| SMILES | CC(C)(C)C(=O)N(Cc1ccccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H25NO/c1-24(2,3)23(26)25(18-19-12-6-4-7-13-19)22-17-11-10-16-21(22)20-14-8-5-9-15-20/h4-17H,18H2,1-3H3 |
| InChIKey | JARALESPMAUDJZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |