C21H25NO3 — CID 84560964
3-[[N-(2,2-dimethylpropanoyl)-2-ethylanilino]methyl]benzoic acid (PubChem CID 84560964) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[[N-(2,2-dimethylpropanoyl)-2-ethylanilino]methyl]benzoic acid.
| Compound Name | 3-[[N-(2,2-dimethylpropanoyl)-2-ethylanilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 84560964 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-[[N-(2,2-dimethylpropanoyl)-2-ethylanilino]methyl]benzoic acid |
| SMILES | CCc1ccccc1N(Cc1cccc(C(=O)O)c1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H25NO3/c1-5-16-10-6-7-12-18(16)22(20(25)21(2,3)4)14-15-9-8-11-17(13-15)19(23)24/h6-13H,5,14H2,1-4H3,(H,23,24) |
| InChIKey | TVGVVFRUKOELAN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |