C18H19F3N2O2 — CID 166062373
N-hydroxy-2,2-dimethyl-N-[[4-(2,4,6-trifluoroanilino)phenyl]methyl]propanamide (PubChem CID 166062373) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethyl-N-[[4-(2,4,6-trifluoroanilino)phenyl]methyl]propanamide.
| Compound Name | N-hydroxy-2,2-dimethyl-N-[[4-(2,4,6-trifluoroanilino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 166062373 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-hydroxy-2,2-dimethyl-N-[[4-(2,4,6-trifluoroanilino)phenyl]methyl]propanamide |
| SMILES | CC(C)(C)C(=O)N(O)Cc1ccc(Nc2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H19F3N2O2/c1-18(2,3)17(24)23(25)10-11-4-6-13(7-5-11)22-16-14(20)8-12(19)9-15(16)21/h4-9,22,25H,10H2,1-3H3 |
| InChIKey | PKRIJADVGFCPSB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|