C24H33FN2O5 — CID 166062007
N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide (PubChem CID 166062007) has the molecular formula C24H33FN2O5 and a molecular weight of 448.54 g/mol. Its IUPAC name is N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide.
| Compound Name | N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 166062007 |
| Molecular Formula | C24H33FN2O5 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[[4-(4-tert-butyl-3-fluoroanilino)phenyl]methyl]-N-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]acetamide |
| SMILES | COCCOCCOCC(=O)N(O)Cc1ccc(Nc2ccc(C(C)(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C24H33FN2O5/c1-24(2,3)21-10-9-20(15-22(21)25)26-19-7-5-18(6-8-19)16-27(29)23(28)17-32-14-13-31-12-11-30-4/h5-10,15,26,29H,11-14,16-17H2,1-4H3 |
| InChIKey | CZINNKCZVOSBGB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|