C16H15N9 — CID 118918788
4-N,6-N-bis[(E)-pyridin-2-ylmethylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 118918788) has the molecular formula C16H15N9 and a molecular weight of 333.36 g/mol. Its IUPAC name is 4-N,6-N-bis[(E)-pyridin-2-ylmethylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis[(E)-pyridin-2-ylmethylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 118918788 |
| Molecular Formula | C16H15N9 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-N,6-N-bis[(E)-pyridin-2-ylmethylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(N/N=C/c2ccccn2)cc(N/N=C/c2ccccn2)n1 |
| InChI | InChI=1S/C16H15N9/c17-16-22-14(24-20-10-12-5-1-3-7-18-12)9-15(23-16)25-21-11-13-6-2-4-8-19-13/h1-11H,(H4,17,22,23,24,25)/b20-10+,21-11+ |
| InChIKey | CTBZEHZMTNSMHC-CLVAPQHMSA-N |
| XLogP | 1.74 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|