C23H29N5OS — CID 11891885
2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11891885) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is 2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11891885 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@H]1[C@@H](NC(=O)CSc2nnc(Cc3cccc4ccccc34)n2N)CCC[C@@H]1C |
| InChI | InChI=1S/C23H29N5OS/c1-15-7-5-12-20(16(15)2)25-22(29)14-30-23-27-26-21(28(23)24)13-18-10-6-9-17-8-3-4-11-19(17)18/h3-4,6,8-11,15-16,20H,5,7,12-14,24H2,1-2H3,(H,25,29)/t15-,16+,20-/m0/s1 |
| InChIKey | OWOLNENWCPSVMN-YRNRMSPPSA-N |
| XLogP | 3.77 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |