C25H25N5OS — CID 4875230
2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 4875230) has the molecular formula C25H25N5OS and a molecular weight of 443.58 g/mol. Its IUPAC name is 2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 4875230 |
| Molecular Formula | C25H25N5OS |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[[4-amino-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | Nn1c(Cc2cccc3ccccc23)nnc1SCC(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C25H25N5OS/c26-30-23(15-19-11-5-9-17-7-1-3-12-20(17)19)28-29-25(30)32-16-24(31)27-22-14-6-10-18-8-2-4-13-21(18)22/h1-5,7-9,11-13,22H,6,10,14-16,26H2,(H,27,31) |
| InChIKey | FLTFDJWPELOLPE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |