C14H27N3 — CID 118919039
1,4-dipentyl-2H-pyrimidin-2-amine (PubChem CID 118919039) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 1,4-dipentyl-2H-pyrimidin-2-amine.
| Compound Name | 1,4-dipentyl-2H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 118919039 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1,4-dipentyl-2H-pyrimidin-2-amine |
| SMILES | CCCCCC1=NC(N)N(CCCCC)C=C1 |
| InChI | InChI=1S/C14H27N3/c1-3-5-7-9-13-10-12-17(14(15)16-13)11-8-6-4-2/h10,12,14H,3-9,11,15H2,1-2H3 |
| InChIKey | HGHZUTIYEJFMOZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|