C19H19ClN2O5 — CID 118920429
[1-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-3-methyl-5-oxo-2H-pyrrol-2-yl] phenyl carbonate (PubChem CID 118920429) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is [1-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-3-methyl-5-oxo-2H-pyrrol-2-yl] phenyl carbonate.
| Compound Name | [1-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-3-methyl-5-oxo-2H-pyrrol-2-yl] phenyl carbonate |
|---|---|
| PubChem CID | 118920429 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [1-(5-tert-butyl-1,2-oxazol-3-yl)-4-chloro-3-methyl-5-oxo-2H-pyrrol-2-yl] phenyl carbonate |
| SMILES | CC1=C(Cl)C(=O)N(c2cc(C(C)(C)C)on2)C1OC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H19ClN2O5/c1-11-15(20)16(23)22(14-10-13(27-21-14)19(2,3)4)17(11)26-18(24)25-12-8-6-5-7-9-12/h5-10,17H,1-4H3 |
| InChIKey | WWTXDVRFNSBDNK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|