C24H38N2O4 — CID 118922734
[1,1,2,3,4,4,6,6,7,7,11b-undecadeuterio-9,10-dimethoxy-3-(2-methylpropyl)benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 118922734) has the molecular formula C24H38N2O4 and a molecular weight of 429.65 g/mol. Its IUPAC name is [1,1,2,3,4,4,6,6,7,7,11b-undecadeuterio-9,10-dimethoxy-3-(2-methylpropyl)benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [1,1,2,3,4,4,6,6,7,7,11b-undecadeuterio-9,10-dimethoxy-3-(2-methylpropyl)benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 118922734 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.35 |
| IUPAC Name | [1,1,2,3,4,4,6,6,7,7,11b-undecadeuterio-9,10-dimethoxy-3-(2-methylpropyl)benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | [2H]C1([2H])c2cc(OC)c(OC)cc2C2([2H])N(C1([2H])[2H])C([2H])([2H])C([2H])(CC(C)C)C([2H])(OC(=O)[C@@H](N)C(C)C)C2([2H])[2H] |
| InChI | InChI=1S/C24H38N2O4/c1-14(2)9-17-13-26-8-7-16-10-21(28-5)22(29-6)11-18(16)19(26)12-20(17)30-24(27)23(25)15(3)4/h10-11,14-15,17,19-20,23H,7-9,12-13,25H2,1-6H3/t17?,19?,20?,23-/m0/s1/i7D2,8D2,12D2,13D2,17D,19D,20D |
| InChIKey | GEJDGVNQKABXKG-QNSHOPKXSA-N |
| XLogP | 3.56 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |