C25H40N2O4 — CID 157299691
[1,1,3,4,4,6,6,7,7,11b-decadeuterio-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 157299691) has the molecular formula C25H40N2O4 and a molecular weight of 445.68 g/mol. Its IUPAC name is [1,1,3,4,4,6,6,7,7,11b-decadeuterio-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [1,1,3,4,4,6,6,7,7,11b-decadeuterio-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 157299691 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.38 |
| IUPAC Name | [1,1,3,4,4,6,6,7,7,11b-decadeuterio-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC)C1([2H])N(C([2H])([2H])C2([2H])[2H])C([2H])([2H])C([2H])(CC(C)(C)C)C(OC(=O)[C@@H](N)C(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C25H40N2O4/c1-15(2)23(26)24(28)31-20-12-19-18-11-22(30-7)21(29-6)10-16(18)8-9-27(19)14-17(20)13-25(3,4)5/h10-11,15,17,19-20,23H,8-9,12-14,26H2,1-7H3/t17?,19?,20?,23-/m0/s1/i6D3,8D2,9D2,12D2,14D2,17D,19D |
| InChIKey | ZWJSRRWNCVZGLB-YQSMIHIJSA-N |
| XLogP | 3.95 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |