C22H27NO2 — CID 118924503
[(14R,19S)-5,11,19-trimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-15-yl]methanol (PubChem CID 118924503) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is [(14R,19S)-5,11,19-trimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-15-yl]methanol.
| Compound Name | [(14R,19S)-5,11,19-trimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-15-yl]methanol |
|---|---|
| PubChem CID | 118924503 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | [(14R,19S)-5,11,19-trimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-15-yl]methanol |
| SMILES | Cc1ccc2c3c1O[C@H]1C4(CO)C=CC5(C[C@@H]4C)C(C2)N(C)CCC315 |
| InChI | InChI=1S/C22H27NO2/c1-13-4-5-15-10-16-21-7-6-20(12-24,14(2)11-21)19-22(21,8-9-23(16)3)17(15)18(13)25-19/h4-7,14,16,19,24H,8-12H2,1-3H3/t14-,16?,19-,20?,21?,22?/m0/s1 |
| InChIKey | YDNLROHCGIINLC-NUXAVEMSSA-N |
| XLogP | 2.83 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|