C30H31Cl2N7O3S — CID 118929450
1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-methylurea (PubChem CID 118929450) has the molecular formula C30H31Cl2N7O3S and a molecular weight of 640.60 g/mol. Its IUPAC name is 1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-methylurea.
| Compound Name | 1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 118929450 |
| Molecular Formula | C30H31Cl2N7O3S |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 639.16 |
| IUPAC Name | 1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-methylurea |
| SMILES | CN(C(=O)NCc1ccc(Cl)c(Cl)c1)N1CCN(Cc2cccc3sc(N)nc23)C(=O)[C@H](Cc2ccccc2)NC(=O)C1 |
| InChI | InChI=1S/C30H31Cl2N7O3S/c1-37(30(42)34-16-20-10-11-22(31)23(32)14-20)39-13-12-38(17-21-8-5-9-25-27(21)36-29(33)43-25)28(41)24(35-26(40)18-39)15-19-6-3-2-4-7-19/h2-11,14,24H,12-13,15-18H2,1H3,(H2,33,36)(H,34,42)(H,35,40)/t24-/m0/s1 |
| InChIKey | NRUQBURNKMKTHT-DEOSSOPVSA-N |
| XLogP | 4.31 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |