C31H31Cl2N7O3S — CID 118929628
1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-5-phenyl-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea (PubChem CID 118929628) has the molecular formula C31H31Cl2N7O3S and a molecular weight of 652.61 g/mol. Its IUPAC name is 1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-5-phenyl-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea.
| Compound Name | 1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-5-phenyl-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 118929628 |
| Molecular Formula | C31H31Cl2N7O3S |
| Molecular Weight | 652.61 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | 1-[(5S)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-3,6-dioxo-5-phenyl-1,4,7-triazonan-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccc(Cl)c(Cl)c1)N1CCN(Cc2cccc3sc(N)nc23)C(=O)[C@H](c2ccccc2)NC(=O)C1 |
| InChI | InChI=1S/C31H31Cl2N7O3S/c1-2-13-40(31(43)35-17-20-11-12-23(32)24(33)16-20)39-15-14-38(18-22-9-6-10-25-27(22)37-30(34)44-25)29(42)28(36-26(41)19-39)21-7-4-3-5-8-21/h2-12,16,28H,1,13-15,17-19H2,(H2,34,37)(H,35,43)(H,36,41)/t28-/m0/s1 |
| InChIKey | QDURAXMMNPCKGC-NDEPHWFRSA-N |
| XLogP | 5.00 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|