C9H11N3O — CID 118929891
5-(1,3-dimethylpyrazol-4-yl)-3-methyl-1,2-oxazole (PubChem CID 118929891) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-(1,3-dimethylpyrazol-4-yl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(1,3-dimethylpyrazol-4-yl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 118929891 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 5-(1,3-dimethylpyrazol-4-yl)-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2cn(C)nc2C)on1 |
| InChI | InChI=1S/C9H11N3O/c1-6-4-9(13-11-6)8-5-12(3)10-7(8)2/h4-5H,1-3H3 |
| InChIKey | GUTSHXWCCCMCQQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |